C30H46O2 — CID 19003417
4-[6-[4-hydroxy-3-methyl-5-(2-methylbutan-2-yl)phenyl]hexyl]-2-methyl-6-(2-methylbutan-2-yl)phenol (PubChem CID 19003417) has the molecular formula C30H46O2 and a molecular weight of 438.70 g/mol. Its IUPAC name is 4-[6-[4-hydroxy-3-methyl-5-(2-methylbutan-2-yl)phenyl]hexyl]-2-methyl-6-(2-methylbutan-2-yl)phenol.
| Compound Name | 4-[6-[4-hydroxy-3-methyl-5-(2-methylbutan-2-yl)phenyl]hexyl]-2-methyl-6-(2-methylbutan-2-yl)phenol |
|---|---|
| PubChem CID | 19003417 |
| Molecular Formula | C30H46O2 |
| Molecular Weight | 438.70 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | 4-[6-[4-hydroxy-3-methyl-5-(2-methylbutan-2-yl)phenyl]hexyl]-2-methyl-6-(2-methylbutan-2-yl)phenol |
| SMILES | CCC(C)(C)c1cc(CCCCCCc2cc(C)c(O)c(C(C)(C)CC)c2)cc(C)c1O |
| InChI | InChI=1S/C30H46O2/c1-9-29(5,6)25-19-23(17-21(3)27(25)31)15-13-11-12-14-16-24-18-22(4)28(32)26(20-24)30(7,8)10-2/h17-20,31-32H,9-16H2,1-8H3 |
| InChIKey | FFUAAUAJUUWBRZ-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.70 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|