C19H27NO — CID 90802349
N-(2-methylpropyl)-9-phenylnona-2,4-dienamide (PubChem CID 90802349) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is N-(2-methylpropyl)-9-phenylnona-2,4-dienamide.
| Compound Name | N-(2-methylpropyl)-9-phenylnona-2,4-dienamide |
|---|---|
| PubChem CID | 90802349 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | N-(2-methylpropyl)-9-phenylnona-2,4-dienamide |
| SMILES | CC(C)CNC(=O)C=CC=CCCCCc1ccccc1 |
| InChI | InChI=1S/C19H27NO/c1-17(2)16-20-19(21)15-11-6-4-3-5-8-12-18-13-9-7-10-14-18/h4,6-7,9-11,13-15,17H,3,5,8,12,16H2,1-2H3,(H,20,21) |
| InChIKey | YZGDQQSFXCPQEY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|