C16H21NO — CID 5281870
(2E,4E)-N-(2-methylpropyl)-6-phenylhexa-2,4-dienamide (PubChem CID 5281870) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is (2E,4E)-N-(2-methylpropyl)-6-phenylhexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-(2-methylpropyl)-6-phenylhexa-2,4-dienamide |
|---|---|
| PubChem CID | 5281870 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | (2E,4E)-N-(2-methylpropyl)-6-phenylhexa-2,4-dienamide |
| SMILES | CC(C)CNC(=O)/C=C/C=C/Cc1ccccc1 |
| InChI | InChI=1S/C16H21NO/c1-14(2)13-17-16(18)12-8-4-7-11-15-9-5-3-6-10-15/h3-10,12,14H,11,13H2,1-2H3,(H,17,18)/b7-4+,12-8+ |
| InChIKey | APSXSFZATMGGAT-HCFISPQYSA-N |
| XLogP | 3.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|