C15H21NOS — CID 134093332
(E)-N-(2-methylpropyl)-3-(2-phenylethylsulfanyl)prop-2-enamide (PubChem CID 134093332) has the molecular formula C15H21NOS and a molecular weight of 263.41 g/mol. Its IUPAC name is (E)-N-(2-methylpropyl)-3-(2-phenylethylsulfanyl)prop-2-enamide.
| Compound Name | (E)-N-(2-methylpropyl)-3-(2-phenylethylsulfanyl)prop-2-enamide |
|---|---|
| PubChem CID | 134093332 |
| Molecular Formula | C15H21NOS |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | (E)-N-(2-methylpropyl)-3-(2-phenylethylsulfanyl)prop-2-enamide |
| SMILES | CC(C)CNC(=O)/C=C/SCCc1ccccc1 |
| InChI | InChI=1S/C15H21NOS/c1-13(2)12-16-15(17)9-11-18-10-8-14-6-4-3-5-7-14/h3-7,9,11,13H,8,10,12H2,1-2H3,(H,16,17)/b11-9+ |
| InChIKey | VMGKMUPTBPGXAT-PKNBQFBNSA-N |
| XLogP | 3.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|