C16H23NS — CID 19908483
(E)-N-(2-methylpropyl)-6-phenylhex-2-enethioamide (PubChem CID 19908483) has the molecular formula C16H23NS and a molecular weight of 261.43 g/mol. Its IUPAC name is (E)-N-(2-methylpropyl)-6-phenylhex-2-enethioamide.
| Compound Name | (E)-N-(2-methylpropyl)-6-phenylhex-2-enethioamide |
|---|---|
| PubChem CID | 19908483 |
| Molecular Formula | C16H23NS |
| Molecular Weight | 261.43 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | (E)-N-(2-methylpropyl)-6-phenylhex-2-enethioamide |
| SMILES | CC(C)CNC(=S)/C=C/CCCc1ccccc1 |
| InChI | InChI=1S/C16H23NS/c1-14(2)13-17-16(18)12-8-4-7-11-15-9-5-3-6-10-15/h3,5-6,8-10,12,14H,4,7,11,13H2,1-2H3,(H,17,18)/b12-8+ |
| InChIKey | DSCNXGZIDCCHRA-XYOKQWHBSA-N |
| XLogP | 4.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.43 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|