C19H24F3NO — CID 88635399
(2E,4E)-N-(2-methylpropyl)-8-[3-(trifluoromethyl)phenyl]octa-2,4-dienamide (PubChem CID 88635399) has the molecular formula C19H24F3NO and a molecular weight of 339.40 g/mol. Its IUPAC name is (2E,4E)-N-(2-methylpropyl)-8-[3-(trifluoromethyl)phenyl]octa-2,4-dienamide.
| Compound Name | (2E,4E)-N-(2-methylpropyl)-8-[3-(trifluoromethyl)phenyl]octa-2,4-dienamide |
|---|---|
| PubChem CID | 88635399 |
| Molecular Formula | C19H24F3NO |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | (2E,4E)-N-(2-methylpropyl)-8-[3-(trifluoromethyl)phenyl]octa-2,4-dienamide |
| SMILES | CC(C)CNC(=O)/C=C/C=C/CCCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H24F3NO/c1-15(2)14-23-18(24)12-7-5-3-4-6-9-16-10-8-11-17(13-16)19(20,21)22/h3,5,7-8,10-13,15H,4,6,9,14H2,1-2H3,(H,23,24)/b5-3+,12-7+ |
| InChIKey | XEROLFQRBIFXSG-PPRDQHCASA-N |
| XLogP | 4.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|