C20H24F3NO2 — CID 89484445
(2E,4E)-N-(oxolan-3-ylmethyl)-8-[3-(trifluoromethyl)phenyl]octa-2,4-dienamide (PubChem CID 89484445) has the molecular formula C20H24F3NO2 and a molecular weight of 367.41 g/mol. Its IUPAC name is (2E,4E)-N-(oxolan-3-ylmethyl)-8-[3-(trifluoromethyl)phenyl]octa-2,4-dienamide.
| Compound Name | (2E,4E)-N-(oxolan-3-ylmethyl)-8-[3-(trifluoromethyl)phenyl]octa-2,4-dienamide |
|---|---|
| PubChem CID | 89484445 |
| Molecular Formula | C20H24F3NO2 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | (2E,4E)-N-(oxolan-3-ylmethyl)-8-[3-(trifluoromethyl)phenyl]octa-2,4-dienamide |
| SMILES | O=C(/C=C/C=C/CCCc1cccc(C(F)(F)F)c1)NCC1CCOC1 |
| InChI | InChI=1S/C20H24F3NO2/c21-20(22,23)18-9-6-8-16(13-18)7-4-2-1-3-5-10-19(25)24-14-17-11-12-26-15-17/h1,3,5-6,8-10,13,17H,2,4,7,11-12,14-15H2,(H,24,25)/b3-1+,10-5+ |
| InChIKey | LVNGRRNSAOPBAU-MZCGDCDISA-N |
| XLogP | 4.29 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|