About N-(oxolan-3-ylmethyl)deca-2,4-dien-9-ynamide
N-(oxolan-3-ylmethyl)deca-2,4-dien-9-ynamide (PubChem CID 123298694) has the molecular formula C15H21NO2
and a molecular weight of 247.34 g/mol. Its IUPAC name is N-(oxolan-3-ylmethyl)deca-2,4-dien-9-ynamide.
Molecular Properties
| Compound Name | N-(oxolan-3-ylmethyl)deca-2,4-dien-9-ynamide |
| PubChem CID | 123298694 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | N-(oxolan-3-ylmethyl)deca-2,4-dien-9-ynamide |
| SMILES | C#CCCCC=CC=CC(=O)NCC1CCOC1 |
| InChI | InChI=1S/C15H21NO2/c1-2-3-4-5-6-7-8-9-15(17)16-12-14-10-11-18-13-14/h1,6-9,14H,3-5,10-13H2,(H,16,17) |
| InChIKey | BENGJICIHMJLKQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(oxolan-3-ylmethyl)deca-2,4-dien-9-ynamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(oxolan-3-ylmethyl)deca-2,4-dien-9-ynamide?
The IUPAC name of N-(oxolan-3-ylmethyl)deca-2,4-dien-9-ynamide (CID 123298694) is N-(oxolan-3-ylmethyl)deca-2,4-dien-9-ynamide.
What is the SMILES notation for N-(oxolan-3-ylmethyl)deca-2,4-dien-9-ynamide?
The canonical SMILES for N-(oxolan-3-ylmethyl)deca-2,4-dien-9-ynamide is C#CCCCC=CC=CC(=O)NCC1CCOC1.
What is the InChIKey of N-(oxolan-3-ylmethyl)deca-2,4-dien-9-ynamide?
The InChIKey is BENGJICIHMJLKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO2/c1-2-3-4-5-6-7-8-9-15(17)16-12-14-10-11-18-13-14/h1,6-9,14H,3-5,10-13H2,(H,16,17).
What are the key properties of N-(oxolan-3-ylmethyl)deca-2,4-dien-9-ynamide?
N-(oxolan-3-ylmethyl)deca-2,4-dien-9-ynamide has a molecular weight of 247.34 g/mol, XLogP of 2.06, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(oxolan-3-ylmethyl)deca-2,4-dien-9-ynamide is sourced from PubChem (CID 123298694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).