C16H23NO2 — CID 88962638
N-(oxan-4-ylmethyl)deca-2,4-dien-9-ynamide (PubChem CID 88962638) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is N-(oxan-4-ylmethyl)deca-2,4-dien-9-ynamide.
| Compound Name | N-(oxan-4-ylmethyl)deca-2,4-dien-9-ynamide |
|---|---|
| PubChem CID | 88962638 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | N-(oxan-4-ylmethyl)deca-2,4-dien-9-ynamide |
| SMILES | C#CCCCC=CC=CC(=O)NCC1CCOCC1 |
| InChI | InChI=1S/C16H23NO2/c1-2-3-4-5-6-7-8-9-16(18)17-14-15-10-12-19-13-11-15/h1,6-9,15H,3-5,10-14H2,(H,17,18) |
| InChIKey | CZQNYPVGNHIAFR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|