C13H23N3O4 — CID 108913044
methyl 4-(oxan-4-ylmethylcarbamoyl)piperazine-1-carboxylate (PubChem CID 108913044) has the molecular formula C13H23N3O4 and a molecular weight of 285.34 g/mol. Its IUPAC name is methyl 4-(oxan-4-ylmethylcarbamoyl)piperazine-1-carboxylate.
| Compound Name | methyl 4-(oxan-4-ylmethylcarbamoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108913044 |
| Molecular Formula | C13H23N3O4 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | methyl 4-(oxan-4-ylmethylcarbamoyl)piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(C(=O)NCC2CCOCC2)CC1 |
| InChI | InChI=1S/C13H23N3O4/c1-19-13(18)16-6-4-15(5-7-16)12(17)14-10-11-2-8-20-9-3-11/h11H,2-10H2,1H3,(H,14,17) |
| InChIKey | CKPUHYLSLNUKBO-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |