methyl morpholine-4-carboxylate

C6H11NO3 — CID 12575354

IUPACmethyl morpholine-4-carboxylate
SMILESCOC(=O)N1CCOCC1
InChIInChI=1S/C6H11NO3/c1-9-6(8)7-2-4-10-5-3-7/h2-5H2,1H3
InChIKeyCDRSBPYJKRZQAY-UHFFFAOYSA-N
MW145.16 g/mol
LogP0.09
Rot. Bonds

About methyl morpholine-4-carboxylate

methyl morpholine-4-carboxylate (PubChem CID 12575354) has the molecular formula C6H11NO3 and a molecular weight of 145.16 g/mol. Its IUPAC name is methyl morpholine-4-carboxylate.

Molecular Properties

Compound Namemethyl morpholine-4-carboxylate
PubChem CID12575354
Molecular FormulaC6H11NO3
Molecular Weight145.16 g/mol
Exact Mass145.07
IUPAC Namemethyl morpholine-4-carboxylate
SMILESCOC(=O)N1CCOCC1
InChIInChI=1S/C6H11NO3/c1-9-6(8)7-2-4-10-5-3-7/h2-5H2,1H3
InChIKeyCDRSBPYJKRZQAY-UHFFFAOYSA-N
XLogP0.09
TPSA38.77 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500145.16
LogP ≤ 50.09
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl morpholine-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl morpholine-4-carboxylate?
The IUPAC name of methyl morpholine-4-carboxylate (CID 12575354) is methyl morpholine-4-carboxylate.
What is the SMILES notation for methyl morpholine-4-carboxylate?
The canonical SMILES for methyl morpholine-4-carboxylate is COC(=O)N1CCOCC1.
What is the InChIKey of methyl morpholine-4-carboxylate?
The InChIKey is CDRSBPYJKRZQAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO3/c1-9-6(8)7-2-4-10-5-3-7/h2-5H2,1H3.
What are the key properties of methyl morpholine-4-carboxylate?
methyl morpholine-4-carboxylate has a molecular weight of 145.16 g/mol, XLogP of 0.09, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl morpholine-4-carboxylate is sourced from PubChem (CID 12575354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).