About methyl morpholine-4-carboxylate
methyl morpholine-4-carboxylate (PubChem CID 12575354) has the molecular formula C6H11NO3
and a molecular weight of 145.16 g/mol. Its IUPAC name is methyl morpholine-4-carboxylate.
Molecular Properties
| Compound Name | methyl morpholine-4-carboxylate |
| PubChem CID | 12575354 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | methyl morpholine-4-carboxylate |
| SMILES | COC(=O)N1CCOCC1 |
| InChI | InChI=1S/C6H11NO3/c1-9-6(8)7-2-4-10-5-3-7/h2-5H2,1H3 |
| InChIKey | CDRSBPYJKRZQAY-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl morpholine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl morpholine-4-carboxylate?
The IUPAC name of methyl morpholine-4-carboxylate (CID 12575354) is methyl morpholine-4-carboxylate.
What is the SMILES notation for methyl morpholine-4-carboxylate?
The canonical SMILES for methyl morpholine-4-carboxylate is COC(=O)N1CCOCC1.
What is the InChIKey of methyl morpholine-4-carboxylate?
The InChIKey is CDRSBPYJKRZQAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO3/c1-9-6(8)7-2-4-10-5-3-7/h2-5H2,1H3.
What are the key properties of methyl morpholine-4-carboxylate?
methyl morpholine-4-carboxylate has a molecular weight of 145.16 g/mol, XLogP of 0.09, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl morpholine-4-carboxylate is sourced from PubChem (CID 12575354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).