C10H19NO4 — CID 949153
1-(1,4,7-trioxa-10-azacyclododec-10-yl)ethanone (PubChem CID 949153) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is 1-(1,4,7-trioxa-10-azacyclododec-10-yl)ethanone.
| Compound Name | 1-(1,4,7-trioxa-10-azacyclododec-10-yl)ethanone |
|---|---|
| PubChem CID | 949153 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 1-(1,4,7-trioxa-10-azacyclododec-10-yl)ethanone |
| SMILES | CC(=O)N1CCOCCOCCOCC1 |
| InChI | InChI=1S/C10H19NO4/c1-10(12)11-2-4-13-6-8-15-9-7-14-5-3-11/h2-9H2,1H3 |
| InChIKey | MRAOMDMPVBOTLE-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |