C8H14N2O3 — CID 11735587
1-(5-acetyl-1,4,5-oxadiazepan-4-yl)ethanone (PubChem CID 11735587) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is 1-(5-acetyl-1,4,5-oxadiazepan-4-yl)ethanone.
| Compound Name | 1-(5-acetyl-1,4,5-oxadiazepan-4-yl)ethanone |
|---|---|
| PubChem CID | 11735587 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 1-(5-acetyl-1,4,5-oxadiazepan-4-yl)ethanone |
| SMILES | CC(=O)N1CCOCCN1C(C)=O |
| InChI | InChI=1S/C8H14N2O3/c1-7(11)9-3-5-13-6-4-10(9)8(2)12/h3-6H2,1-2H3 |
| InChIKey | MFIYYJKGKXOPMY-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |