About morpholine-4-carbaldehyde;1-morpholin-4-ylethanone
morpholine-4-carbaldehyde;1-morpholin-4-ylethanone (PubChem CID 158454049) has the molecular formula C11H20N2O4
and a molecular weight of 244.29 g/mol. Its IUPAC name is morpholine-4-carbaldehyde;1-morpholin-4-ylethanone.
Molecular Properties
| Compound Name | morpholine-4-carbaldehyde;1-morpholin-4-ylethanone |
| PubChem CID | 158454049 |
| Molecular Formula | C11H20N2O4 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | morpholine-4-carbaldehyde;1-morpholin-4-ylethanone |
| SMILES | CC(=O)N1CCOCC1.O=CN1CCOCC1 |
| InChI | InChI=1S/C6H11NO2.C5H9NO2/c1-6(8)7-2-4-9-5-3-7;7-5-6-1-3-8-4-2-6/h2-5H2,1H3;5H,1-4H2 |
| InChIKey | HEIUJBYAEQDIAN-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze morpholine-4-carbaldehyde;1-morpholin-4-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholine-4-carbaldehyde;1-morpholin-4-ylethanone?
The IUPAC name of morpholine-4-carbaldehyde;1-morpholin-4-ylethanone (CID 158454049) is morpholine-4-carbaldehyde;1-morpholin-4-ylethanone.
What is the SMILES notation for morpholine-4-carbaldehyde;1-morpholin-4-ylethanone?
The canonical SMILES for morpholine-4-carbaldehyde;1-morpholin-4-ylethanone is CC(=O)N1CCOCC1.O=CN1CCOCC1.
What is the InChIKey of morpholine-4-carbaldehyde;1-morpholin-4-ylethanone?
The InChIKey is HEIUJBYAEQDIAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2.C5H9NO2/c1-6(8)7-2-4-9-5-3-7;7-5-6-1-3-8-4-2-6/h2-5H2,1H3;5H,1-4H2.
What are the key properties of morpholine-4-carbaldehyde;1-morpholin-4-ylethanone?
morpholine-4-carbaldehyde;1-morpholin-4-ylethanone has a molecular weight of 244.29 g/mol, XLogP of -0.66, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for morpholine-4-carbaldehyde;1-morpholin-4-ylethanone is sourced from PubChem (CID 158454049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).