About morpholine-4-carbaldehyde;perchloric acid
morpholine-4-carbaldehyde;perchloric acid (PubChem CID 12512320) has the molecular formula C5H10ClNO6
and a molecular weight of 215.59 g/mol. Its IUPAC name is morpholine-4-carbaldehyde;perchloric acid.
Molecular Properties
| Compound Name | morpholine-4-carbaldehyde;perchloric acid |
| PubChem CID | 12512320 |
| Molecular Formula | C5H10ClNO6 |
| Molecular Weight | 215.59 g/mol |
| Exact Mass | 215.02 |
| IUPAC Name | morpholine-4-carbaldehyde;perchloric acid |
| SMILES | O=CN1CCOCC1.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C5H9NO2.ClHO4/c7-5-6-1-3-8-4-2-6;2-1(3,4)5/h5H,1-4H2;(H,2,3,4,5) |
| InChIKey | FMMOGDFQXUEQIO-UHFFFAOYSA-N |
| XLogP | -4.65 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.59 |
| LogP ≤ 5 | -4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze morpholine-4-carbaldehyde;perchloric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholine-4-carbaldehyde;perchloric acid?
The IUPAC name of morpholine-4-carbaldehyde;perchloric acid (CID 12512320) is morpholine-4-carbaldehyde;perchloric acid.
What is the SMILES notation for morpholine-4-carbaldehyde;perchloric acid?
The canonical SMILES for morpholine-4-carbaldehyde;perchloric acid is O=CN1CCOCC1.[O-][Cl+3]([O-])([O-])O.
What is the InChIKey of morpholine-4-carbaldehyde;perchloric acid?
The InChIKey is FMMOGDFQXUEQIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO2.ClHO4/c7-5-6-1-3-8-4-2-6;2-1(3,4)5/h5H,1-4H2;(H,2,3,4,5).
What are the key properties of morpholine-4-carbaldehyde;perchloric acid?
morpholine-4-carbaldehyde;perchloric acid has a molecular weight of 215.59 g/mol, XLogP of -4.65, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for morpholine-4-carbaldehyde;perchloric acid is sourced from PubChem (CID 12512320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).