morpholine-4-carbaldehyde;perchloric acid

C5H10ClNO6 — CID 12512320

IUPACmorpholine-4-carbaldehyde;perchloric acid
SMILESO=CN1CCOCC1.[O-][Cl+3]([O-])([O-])O
InChIInChI=1S/C5H9NO2.ClHO4/c7-5-6-1-3-8-4-2-6;2-1(3,4)5/h5H,1-4H2;(H,2,3,4,5)
InChIKeyFMMOGDFQXUEQIO-UHFFFAOYSA-N
MW215.59 g/mol
LogP-4.65
Rot. Bonds1

About morpholine-4-carbaldehyde;perchloric acid

morpholine-4-carbaldehyde;perchloric acid (PubChem CID 12512320) has the molecular formula C5H10ClNO6 and a molecular weight of 215.59 g/mol. Its IUPAC name is morpholine-4-carbaldehyde;perchloric acid.

Molecular Properties

Compound Namemorpholine-4-carbaldehyde;perchloric acid
PubChem CID12512320
Molecular FormulaC5H10ClNO6
Molecular Weight215.59 g/mol
Exact Mass215.02
IUPAC Namemorpholine-4-carbaldehyde;perchloric acid
SMILESO=CN1CCOCC1.[O-][Cl+3]([O-])([O-])O
InChIInChI=1S/C5H9NO2.ClHO4/c7-5-6-1-3-8-4-2-6;2-1(3,4)5/h5H,1-4H2;(H,2,3,4,5)
InChIKeyFMMOGDFQXUEQIO-UHFFFAOYSA-N
XLogP-4.65
TPSA118.95 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.59
LogP ≤ 5-4.65
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze morpholine-4-carbaldehyde;perchloric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of morpholine-4-carbaldehyde;perchloric acid?
The IUPAC name of morpholine-4-carbaldehyde;perchloric acid (CID 12512320) is morpholine-4-carbaldehyde;perchloric acid.
What is the SMILES notation for morpholine-4-carbaldehyde;perchloric acid?
The canonical SMILES for morpholine-4-carbaldehyde;perchloric acid is O=CN1CCOCC1.[O-][Cl+3]([O-])([O-])O.
What is the InChIKey of morpholine-4-carbaldehyde;perchloric acid?
The InChIKey is FMMOGDFQXUEQIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO2.ClHO4/c7-5-6-1-3-8-4-2-6;2-1(3,4)5/h5H,1-4H2;(H,2,3,4,5).
What are the key properties of morpholine-4-carbaldehyde;perchloric acid?
morpholine-4-carbaldehyde;perchloric acid has a molecular weight of 215.59 g/mol, XLogP of -4.65, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for morpholine-4-carbaldehyde;perchloric acid is sourced from PubChem (CID 12512320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).