C15H25NO2 — CID 142911408
ethane;morpholine-4-carbaldehyde;1,3-xylene (PubChem CID 142911408) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is ethane;morpholine-4-carbaldehyde;1,3-xylene.
| Compound Name | ethane;morpholine-4-carbaldehyde;1,3-xylene |
|---|---|
| PubChem CID | 142911408 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | ethane;morpholine-4-carbaldehyde;1,3-xylene |
| SMILES | CC.Cc1cccc(C)c1.O=CN1CCOCC1 |
| InChI | InChI=1S/C8H10.C5H9NO2.C2H6/c1-7-4-3-5-8(2)6-7;7-5-6-1-3-8-4-2-6;1-2/h3-6H,1-2H3;5H,1-4H2;1-2H3 |
| InChIKey | KCNNOZQWDGBONP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|