C17H26N2O2 — CID 143615513
ethane;5-(3-methylphenyl)-4,5-dihydro-1,3-oxazole;pyrrolidine-1-carbaldehyde (PubChem CID 143615513) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is ethane;5-(3-methylphenyl)-4,5-dihydro-1,3-oxazole;pyrrolidine-1-carbaldehyde.
| Compound Name | ethane;5-(3-methylphenyl)-4,5-dihydro-1,3-oxazole;pyrrolidine-1-carbaldehyde |
|---|---|
| PubChem CID | 143615513 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | ethane;5-(3-methylphenyl)-4,5-dihydro-1,3-oxazole;pyrrolidine-1-carbaldehyde |
| SMILES | CC.Cc1cccc(C2CN=CO2)c1.O=CN1CCCC1 |
| InChI | InChI=1S/C10H11NO.C5H9NO.C2H6/c1-8-3-2-4-9(5-8)10-6-11-7-12-10;7-5-6-3-1-2-4-6;1-2/h2-5,7,10H,6H2,1H3;5H,1-4H2;1-2H3 |
| InChIKey | KPHOEUMWNABERP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|