C18H23IN2 — CID 173456606
1,2-dimethyl-3-(3-methylphenyl)-5-phenylpyrazolidine;hydroiodide (PubChem CID 173456606) has the molecular formula C18H23IN2 and a molecular weight of 394.30 g/mol. Its IUPAC name is 1,2-dimethyl-3-(3-methylphenyl)-5-phenylpyrazolidine;hydroiodide.
| Compound Name | 1,2-dimethyl-3-(3-methylphenyl)-5-phenylpyrazolidine;hydroiodide |
|---|---|
| PubChem CID | 173456606 |
| Molecular Formula | C18H23IN2 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 1,2-dimethyl-3-(3-methylphenyl)-5-phenylpyrazolidine;hydroiodide |
| SMILES | Cc1cccc(C2CC(c3ccccc3)N(C)N2C)c1.I |
| InChI | InChI=1S/C18H22N2.HI/c1-14-8-7-11-16(12-14)18-13-17(19(2)20(18)3)15-9-5-4-6-10-15;/h4-12,17-18H,13H2,1-3H3;1H |
| InChIKey | JENPONVCOIRJLT-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|