C16H28N2O2S — CID 169106960
ethane;1-oxo-1,4-thiazinane-4-carbaldehyde;N,N,3-trimethylaniline (PubChem CID 169106960) has the molecular formula C16H28N2O2S and a molecular weight of 312.48 g/mol. Its IUPAC name is ethane;1-oxo-1,4-thiazinane-4-carbaldehyde;N,N,3-trimethylaniline.
| Compound Name | ethane;1-oxo-1,4-thiazinane-4-carbaldehyde;N,N,3-trimethylaniline |
|---|---|
| PubChem CID | 169106960 |
| Molecular Formula | C16H28N2O2S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | ethane;1-oxo-1,4-thiazinane-4-carbaldehyde;N,N,3-trimethylaniline |
| SMILES | CC.Cc1cccc(N(C)C)c1.O=CN1CCS(=O)CC1 |
| InChI | InChI=1S/C9H13N.C5H9NO2S.C2H6/c1-8-5-4-6-9(7-8)10(2)3;7-5-6-1-3-9(8)4-2-6;1-2/h4-7H,1-3H3;5H,1-4H2;1-2H3 |
| InChIKey | KNPODQGZJQKQJN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|