C19H28N2 — CID 67788378
N,N-diethylaniline;N,N,3-trimethylaniline (PubChem CID 67788378) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is N,N-diethylaniline;N,N,3-trimethylaniline.
| Compound Name | N,N-diethylaniline;N,N,3-trimethylaniline |
|---|---|
| PubChem CID | 67788378 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | N,N-diethylaniline;N,N,3-trimethylaniline |
| SMILES | CCN(CC)c1ccccc1.Cc1cccc(N(C)C)c1 |
| InChI | InChI=1S/C10H15N.C9H13N/c1-3-11(4-2)10-8-6-5-7-9-10;1-8-5-4-6-9(7-8)10(2)3/h5-9H,3-4H2,1-2H3;4-7H,1-3H3 |
| InChIKey | JMXVYJSLIHJGJH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |