About CID 138691650
CID 138691650 (PubChem CID 138691650) has the molecular formula C9H13LiN
and a molecular weight of 142.15 g/mol.
Molecular Properties
| Compound Name | CID 138691650 |
| PubChem CID | 138691650 |
| Molecular Formula | C9H13LiN |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.12 |
| IUPAC Name | — |
| SMILES | Cc1cccc(N(C)C)c1.[Li] |
| InChI | InChI=1S/C9H13N.Li/c1-8-5-4-6-9(7-8)10(2)3;/h4-7H,1-3H3; |
| InChIKey | FSSPHVKVFOXYCC-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 138691650 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 138691650?
The IUPAC name of CID 138691650 (CID 138691650) is not available.
What is the SMILES notation for CID 138691650?
The canonical SMILES for CID 138691650 is Cc1cccc(N(C)C)c1.[Li].
What is the InChIKey of CID 138691650?
The InChIKey is FSSPHVKVFOXYCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N.Li/c1-8-5-4-6-9(7-8)10(2)3;/h4-7H,1-3H3;.
What are the key properties of CID 138691650?
CID 138691650 has a molecular weight of 142.15 g/mol, XLogP of 1.68, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 138691650 is sourced from PubChem (CID 138691650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).