C14H28N2 — CID 90858464
ethane;1-N,1-N,3-N,3-N-tetramethylbenzene-1,3-diamine (PubChem CID 90858464) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is ethane;1-N,1-N,3-N,3-N-tetramethylbenzene-1,3-diamine.
| Compound Name | ethane;1-N,1-N,3-N,3-N-tetramethylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 90858464 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | ethane;1-N,1-N,3-N,3-N-tetramethylbenzene-1,3-diamine |
| SMILES | CC.CC.CN(C)c1cccc(N(C)C)c1 |
| InChI | InChI=1S/C10H16N2.2C2H6/c1-11(2)9-6-5-7-10(8-9)12(3)4;2*1-2/h5-8H,1-4H3;2*1-2H3 |
| InChIKey | QGXADZSRGADLGG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |