About 3-(dimethylamino)phenol;methoxymethane
3-(dimethylamino)phenol;methoxymethane (PubChem CID 175600948) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is 3-(dimethylamino)phenol;methoxymethane.
Molecular Properties
| Compound Name | 3-(dimethylamino)phenol;methoxymethane |
| PubChem CID | 175600948 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 3-(dimethylamino)phenol;methoxymethane |
| SMILES | CN(C)c1cccc(O)c1.COC |
| InChI | InChI=1S/C8H11NO.C2H6O/c1-9(2)7-4-3-5-8(10)6-7;1-3-2/h3-6,10H,1-2H3;1-2H3 |
| InChIKey | ULARAAHIVGSOBW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(dimethylamino)phenol;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)phenol;methoxymethane?
The IUPAC name of 3-(dimethylamino)phenol;methoxymethane (CID 175600948) is 3-(dimethylamino)phenol;methoxymethane.
What is the SMILES notation for 3-(dimethylamino)phenol;methoxymethane?
The canonical SMILES for 3-(dimethylamino)phenol;methoxymethane is CN(C)c1cccc(O)c1.COC.
What is the InChIKey of 3-(dimethylamino)phenol;methoxymethane?
The InChIKey is ULARAAHIVGSOBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO.C2H6O/c1-9(2)7-4-3-5-8(10)6-7;1-3-2/h3-6,10H,1-2H3;1-2H3.
What are the key properties of 3-(dimethylamino)phenol;methoxymethane?
3-(dimethylamino)phenol;methoxymethane has a molecular weight of 183.25 g/mol, XLogP of 1.72, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)phenol;methoxymethane is sourced from PubChem (CID 175600948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).