C9H14FN — CID 157466440
3-fluoro-N,N-dimethylaniline;methane (PubChem CID 157466440) has the molecular formula C9H14FN and a molecular weight of 155.22 g/mol. Its IUPAC name is 3-fluoro-N,N-dimethylaniline;methane.
| Compound Name | 3-fluoro-N,N-dimethylaniline;methane |
|---|---|
| PubChem CID | 157466440 |
| Molecular Formula | C9H14FN |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 3-fluoro-N,N-dimethylaniline;methane |
| SMILES | C.CN(C)c1cccc(F)c1 |
| InChI | InChI=1S/C8H10FN.CH4/c1-10(2)8-5-3-4-7(9)6-8;/h3-6H,1-2H3;1H4 |
| InChIKey | BUNNLCLWCRTCCE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |