C8H4F7N — CID 23233631
3-fluoro-N,N-bis(trifluoromethyl)aniline (PubChem CID 23233631) has the molecular formula C8H4F7N and a molecular weight of 247.11 g/mol. Its IUPAC name is 3-fluoro-N,N-bis(trifluoromethyl)aniline.
| Compound Name | 3-fluoro-N,N-bis(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 23233631 |
| Molecular Formula | C8H4F7N |
| Molecular Weight | 247.11 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | 3-fluoro-N,N-bis(trifluoromethyl)aniline |
| SMILES | Fc1cccc(N(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C8H4F7N/c9-5-2-1-3-6(4-5)16(7(10,11)12)8(13,14)15/h1-4H |
| InChIKey | WRQWUUKFUKZFHU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.11 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|