About 3-fluoro-N,N-bis(trifluoromethyl)aniline
3-fluoro-N,N-bis(trifluoromethyl)aniline (PubChem CID 23233631) has the molecular formula C8H4F7N
and a molecular weight of 247.11 g/mol. Its IUPAC name is 3-fluoro-N,N-bis(trifluoromethyl)aniline.
Molecular Properties
| Compound Name | 3-fluoro-N,N-bis(trifluoromethyl)aniline |
| PubChem CID | 23233631 |
| Molecular Formula | C8H4F7N |
| Molecular Weight | 247.11 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | 3-fluoro-N,N-bis(trifluoromethyl)aniline |
| SMILES | Fc1cccc(N(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C8H4F7N/c9-5-2-1-3-6(4-5)16(7(10,11)12)8(13,14)15/h1-4H |
| InChIKey | WRQWUUKFUKZFHU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.11 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-N,N-bis(trifluoromethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-N,N-bis(trifluoromethyl)aniline?
The IUPAC name of 3-fluoro-N,N-bis(trifluoromethyl)aniline (CID 23233631) is 3-fluoro-N,N-bis(trifluoromethyl)aniline.
What is the SMILES notation for 3-fluoro-N,N-bis(trifluoromethyl)aniline?
The canonical SMILES for 3-fluoro-N,N-bis(trifluoromethyl)aniline is Fc1cccc(N(C(F)(F)F)C(F)(F)F)c1.
What is the InChIKey of 3-fluoro-N,N-bis(trifluoromethyl)aniline?
The InChIKey is WRQWUUKFUKZFHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4F7N/c9-5-2-1-3-6(4-5)16(7(10,11)12)8(13,14)15/h1-4H.
What are the key properties of 3-fluoro-N,N-bis(trifluoromethyl)aniline?
3-fluoro-N,N-bis(trifluoromethyl)aniline has a molecular weight of 247.11 g/mol, XLogP of 3.67, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-N,N-bis(trifluoromethyl)aniline is sourced from PubChem (CID 23233631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).