C10H16N2 — CID 115226747
N,N'-dimethyl-N'-(3-methylphenyl)methanediamine (PubChem CID 115226747) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is N,N'-dimethyl-N'-(3-methylphenyl)methanediamine.
| Compound Name | N,N'-dimethyl-N'-(3-methylphenyl)methanediamine |
|---|---|
| PubChem CID | 115226747 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | N,N'-dimethyl-N'-(3-methylphenyl)methanediamine |
| SMILES | CNCN(C)c1cccc(C)c1 |
| InChI | InChI=1S/C10H16N2/c1-9-5-4-6-10(7-9)12(3)8-11-2/h4-7,11H,8H2,1-3H3 |
| InChIKey | IQDKETRHYBSTCS-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|