C13H18N2 — CID 62555206
N'-methyl-N'-(3-methylphenyl)-N-prop-2-ynylethane-1,2-diamine (PubChem CID 62555206) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is N'-methyl-N'-(3-methylphenyl)-N-prop-2-ynylethane-1,2-diamine.
| Compound Name | N'-methyl-N'-(3-methylphenyl)-N-prop-2-ynylethane-1,2-diamine |
|---|---|
| PubChem CID | 62555206 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | N'-methyl-N'-(3-methylphenyl)-N-prop-2-ynylethane-1,2-diamine |
| SMILES | C#CCNCCN(C)c1cccc(C)c1 |
| InChI | InChI=1S/C13H18N2/c1-4-8-14-9-10-15(3)13-7-5-6-12(2)11-13/h1,5-7,11,14H,8-10H2,2-3H3 |
| InChIKey | QQBLJKBFZNUNQJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|