C15H24N2 — CID 23460287
N'-methyl-N'-(3-methylphenyl)-N-prop-2-enylbutane-1,4-diamine (PubChem CID 23460287) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is N'-methyl-N'-(3-methylphenyl)-N-prop-2-enylbutane-1,4-diamine.
| Compound Name | N'-methyl-N'-(3-methylphenyl)-N-prop-2-enylbutane-1,4-diamine |
|---|---|
| PubChem CID | 23460287 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | N'-methyl-N'-(3-methylphenyl)-N-prop-2-enylbutane-1,4-diamine |
| SMILES | C=CCNCCCCN(C)c1cccc(C)c1 |
| InChI | InChI=1S/C15H24N2/c1-4-10-16-11-5-6-12-17(3)15-9-7-8-14(2)13-15/h4,7-9,13,16H,1,5-6,10-12H2,2-3H3 |
| InChIKey | HZHIBDXGFPCMJE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|