C17H28N2 — CID 107006435
N-hept-6-enyl-N'-methyl-N'-phenylpropane-1,3-diamine (PubChem CID 107006435) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is N-hept-6-enyl-N'-methyl-N'-phenylpropane-1,3-diamine.
| Compound Name | N-hept-6-enyl-N'-methyl-N'-phenylpropane-1,3-diamine |
|---|---|
| PubChem CID | 107006435 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | N-hept-6-enyl-N'-methyl-N'-phenylpropane-1,3-diamine |
| SMILES | C=CCCCCCNCCCN(C)c1ccccc1 |
| InChI | InChI=1S/C17H28N2/c1-3-4-5-6-10-14-18-15-11-16-19(2)17-12-8-7-9-13-17/h3,7-9,12-13,18H,1,4-6,10-11,14-16H2,2H3 |
| InChIKey | QNVMSFCFHDQQBW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|