C16H24N2O2 — CID 103232573
ethyl 2-[[3-(N-methylanilino)propylamino]methyl]prop-2-enoate (PubChem CID 103232573) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is ethyl 2-[[3-(N-methylanilino)propylamino]methyl]prop-2-enoate.
| Compound Name | ethyl 2-[[3-(N-methylanilino)propylamino]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 103232573 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | ethyl 2-[[3-(N-methylanilino)propylamino]methyl]prop-2-enoate |
| SMILES | C=C(CNCCCN(C)c1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C16H24N2O2/c1-4-20-16(19)14(2)13-17-11-8-12-18(3)15-9-6-5-7-10-15/h5-7,9-10,17H,2,4,8,11-13H2,1,3H3 |
| InChIKey | KVJFTSRVMOOGNM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|