C15H27N3 — CID 114525044
N',N'-dimethyl-N-[3-(N-methylanilino)propyl]propane-1,3-diamine (PubChem CID 114525044) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is N',N'-dimethyl-N-[3-(N-methylanilino)propyl]propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-[3-(N-methylanilino)propyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 114525044 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | N',N'-dimethyl-N-[3-(N-methylanilino)propyl]propane-1,3-diamine |
| SMILES | CN(C)CCCNCCCN(C)c1ccccc1 |
| InChI | InChI=1S/C15H27N3/c1-17(2)13-7-11-16-12-8-14-18(3)15-9-5-4-6-10-15/h4-6,9-10,16H,7-8,11-14H2,1-3H3 |
| InChIKey | RUHRTMHLEKETDO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|