C15H20N4 — CID 62758385
N'-methyl-N'-phenyl-N-(pyrimidin-5-ylmethyl)propane-1,3-diamine (PubChem CID 62758385) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is N'-methyl-N'-phenyl-N-(pyrimidin-5-ylmethyl)propane-1,3-diamine.
| Compound Name | N'-methyl-N'-phenyl-N-(pyrimidin-5-ylmethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 62758385 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | N'-methyl-N'-phenyl-N-(pyrimidin-5-ylmethyl)propane-1,3-diamine |
| SMILES | CN(CCCNCc1cncnc1)c1ccccc1 |
| InChI | InChI=1S/C15H20N4/c1-19(15-6-3-2-4-7-15)9-5-8-16-10-14-11-17-13-18-12-14/h2-4,6-7,11-13,16H,5,8-10H2,1H3 |
| InChIKey | CJDLOPHYUQVOHE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|