C15H22N4 — CID 119111564
N-(1H-imidazol-2-ylmethyl)-N'-methyl-N'-phenylbutane-1,4-diamine (PubChem CID 119111564) has the molecular formula C15H22N4 and a molecular weight of 258.37 g/mol. Its IUPAC name is N-(1H-imidazol-2-ylmethyl)-N'-methyl-N'-phenylbutane-1,4-diamine.
| Compound Name | N-(1H-imidazol-2-ylmethyl)-N'-methyl-N'-phenylbutane-1,4-diamine |
|---|---|
| PubChem CID | 119111564 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | N-(1H-imidazol-2-ylmethyl)-N'-methyl-N'-phenylbutane-1,4-diamine |
| SMILES | CN(CCCCNCc1ncc[nH]1)c1ccccc1 |
| InChI | InChI=1S/C15H22N4/c1-19(14-7-3-2-4-8-14)12-6-5-9-16-13-15-17-10-11-18-15/h2-4,7-8,10-11,16H,5-6,9,12-13H2,1H3,(H,17,18) |
| InChIKey | JBWUFJWRPYWBNT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|