C7H13N3O3S — CID 82676006
3-(1H-imidazol-2-ylmethylamino)propane-1-sulfonic acid (PubChem CID 82676006) has the molecular formula C7H13N3O3S and a molecular weight of 219.27 g/mol. Its IUPAC name is 3-(1H-imidazol-2-ylmethylamino)propane-1-sulfonic acid.
| Compound Name | 3-(1H-imidazol-2-ylmethylamino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 82676006 |
| Molecular Formula | C7H13N3O3S |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 3-(1H-imidazol-2-ylmethylamino)propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCNCc1ncc[nH]1 |
| InChI | InChI=1S/C7H13N3O3S/c11-14(12,13)5-1-2-8-6-7-9-3-4-10-7/h3-4,8H,1-2,5-6H2,(H,9,10)(H,11,12,13) |
| InChIKey | IOZBQIYSXQUREF-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|