C20H26N4O — CID 47620873
N'-methyl-N-[[5-(5-methylfuran-2-yl)-1H-pyrazol-4-yl]methyl]-N'-phenylbutane-1,4-diamine (PubChem CID 47620873) has the molecular formula C20H26N4O and a molecular weight of 338.46 g/mol. Its IUPAC name is N'-methyl-N-[[5-(5-methylfuran-2-yl)-1H-pyrazol-4-yl]methyl]-N'-phenylbutane-1,4-diamine.
| Compound Name | N'-methyl-N-[[5-(5-methylfuran-2-yl)-1H-pyrazol-4-yl]methyl]-N'-phenylbutane-1,4-diamine |
|---|---|
| PubChem CID | 47620873 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | N'-methyl-N-[[5-(5-methylfuran-2-yl)-1H-pyrazol-4-yl]methyl]-N'-phenylbutane-1,4-diamine |
| SMILES | Cc1ccc(-c2[nH]ncc2CNCCCCN(C)c2ccccc2)o1 |
| InChI | InChI=1S/C20H26N4O/c1-16-10-11-19(25-16)20-17(15-22-23-20)14-21-12-6-7-13-24(2)18-8-4-3-5-9-18/h3-5,8-11,15,21H,6-7,12-14H2,1-2H3,(H,22,23) |
| InChIKey | IGEYMMNIXRSTLP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|