C9H16N4 — CID 62763082
N',N'-dimethyl-N-(pyrimidin-5-ylmethyl)ethane-1,2-diamine (PubChem CID 62763082) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is N',N'-dimethyl-N-(pyrimidin-5-ylmethyl)ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-(pyrimidin-5-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62763082 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | N',N'-dimethyl-N-(pyrimidin-5-ylmethyl)ethane-1,2-diamine |
| SMILES | CN(C)CCNCc1cncnc1 |
| InChI | InChI=1S/C9H16N4/c1-13(2)4-3-10-5-9-6-11-8-12-7-9/h6-8,10H,3-5H2,1-2H3 |
| InChIKey | ODEDDJUPKKGBRJ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|