C17H20ClFN2 — CID 81146990
N-[(3-chloro-4-fluorophenyl)methyl]-N'-methyl-N'-phenylpropane-1,3-diamine (PubChem CID 81146990) has the molecular formula C17H20ClFN2 and a molecular weight of 306.81 g/mol. Its IUPAC name is N-[(3-chloro-4-fluorophenyl)methyl]-N'-methyl-N'-phenylpropane-1,3-diamine.
| Compound Name | N-[(3-chloro-4-fluorophenyl)methyl]-N'-methyl-N'-phenylpropane-1,3-diamine |
|---|---|
| PubChem CID | 81146990 |
| Molecular Formula | C17H20ClFN2 |
| Molecular Weight | 306.81 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | N-[(3-chloro-4-fluorophenyl)methyl]-N'-methyl-N'-phenylpropane-1,3-diamine |
| SMILES | CN(CCCNCc1ccc(F)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C17H20ClFN2/c1-21(15-6-3-2-4-7-15)11-5-10-20-13-14-8-9-17(19)16(18)12-14/h2-4,6-9,12,20H,5,10-11,13H2,1H3 |
| InChIKey | NCAWSHQCCQYXAA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.81 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|