C11H14Cl2FN — CID 103041347
3-chloro-N-[(3-chloro-4-fluorophenyl)methyl]butan-1-amine (PubChem CID 103041347) has the molecular formula C11H14Cl2FN and a molecular weight of 250.14 g/mol. Its IUPAC name is 3-chloro-N-[(3-chloro-4-fluorophenyl)methyl]butan-1-amine.
| Compound Name | 3-chloro-N-[(3-chloro-4-fluorophenyl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 103041347 |
| Molecular Formula | C11H14Cl2FN |
| Molecular Weight | 250.14 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | 3-chloro-N-[(3-chloro-4-fluorophenyl)methyl]butan-1-amine |
| SMILES | CC(Cl)CCNCc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C11H14Cl2FN/c1-8(12)4-5-15-7-9-2-3-11(14)10(13)6-9/h2-3,6,8,15H,4-5,7H2,1H3 |
| InChIKey | QZMXCLSDMBQKNK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.14 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|