C13H24N2 — CID 177320801
ethane;N,N,N'-trimethyl-N'-phenylethane-1,2-diamine (PubChem CID 177320801) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is ethane;N,N,N'-trimethyl-N'-phenylethane-1,2-diamine.
| Compound Name | ethane;N,N,N'-trimethyl-N'-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 177320801 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | ethane;N,N,N'-trimethyl-N'-phenylethane-1,2-diamine |
| SMILES | CC.CN(C)CCN(C)c1ccccc1 |
| InChI | InChI=1S/C11H18N2.C2H6/c1-12(2)9-10-13(3)11-7-5-4-6-8-11;1-2/h4-8H,9-10H2,1-3H3;1-2H3 |
| InChIKey | QYUPLNAJNURSGG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |