C15H28N2 — CID 144693045
N'-(3,4-dimethylphenyl)-N,N,N'-trimethylethane-1,2-diamine;ethane (PubChem CID 144693045) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is N'-(3,4-dimethylphenyl)-N,N,N'-trimethylethane-1,2-diamine;ethane.
| Compound Name | N'-(3,4-dimethylphenyl)-N,N,N'-trimethylethane-1,2-diamine;ethane |
|---|---|
| PubChem CID | 144693045 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | N'-(3,4-dimethylphenyl)-N,N,N'-trimethylethane-1,2-diamine;ethane |
| SMILES | CC.Cc1ccc(N(C)CCN(C)C)cc1C |
| InChI | InChI=1S/C13H22N2.C2H6/c1-11-6-7-13(10-12(11)2)15(5)9-8-14(3)4;1-2/h6-7,10H,8-9H2,1-5H3;1-2H3 |
| InChIKey | GNVDYBWZCLMYQR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|