C13H23NO2 — CID 144692969
ethane;2-(3-methoxy-N,4-dimethylanilino)ethanol (PubChem CID 144692969) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is ethane;2-(3-methoxy-N,4-dimethylanilino)ethanol.
| Compound Name | ethane;2-(3-methoxy-N,4-dimethylanilino)ethanol |
|---|---|
| PubChem CID | 144692969 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | ethane;2-(3-methoxy-N,4-dimethylanilino)ethanol |
| SMILES | CC.COc1cc(N(C)CCO)ccc1C |
| InChI | InChI=1S/C11H17NO2.C2H6/c1-9-4-5-10(8-11(9)14-3)12(2)6-7-13;1-2/h4-5,8,13H,6-7H2,1-3H3;1-2H3 |
| InChIKey | FMWURFLFFRQYBT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |