C14H23NO — CID 67208536
3-methoxy-4-methyl-N,N-dipropylaniline (PubChem CID 67208536) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 3-methoxy-4-methyl-N,N-dipropylaniline.
| Compound Name | 3-methoxy-4-methyl-N,N-dipropylaniline |
|---|---|
| PubChem CID | 67208536 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 3-methoxy-4-methyl-N,N-dipropylaniline |
| SMILES | CCCN(CCC)c1ccc(C)c(OC)c1 |
| InChI | InChI=1S/C14H23NO/c1-5-9-15(10-6-2)13-8-7-12(3)14(11-13)16-4/h7-8,11H,5-6,9-10H2,1-4H3 |
| InChIKey | DVMWPHOOXGRIKK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |