C18H37NO3 — CID 142222447
ethane;2-(N-ethyl-3,4-dimethoxyanilino)ethanol (PubChem CID 142222447) has the molecular formula C18H37NO3 and a molecular weight of 315.50 g/mol. Its IUPAC name is ethane;2-(N-ethyl-3,4-dimethoxyanilino)ethanol.
| Compound Name | ethane;2-(N-ethyl-3,4-dimethoxyanilino)ethanol |
|---|---|
| PubChem CID | 142222447 |
| Molecular Formula | C18H37NO3 |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.28 |
| IUPAC Name | ethane;2-(N-ethyl-3,4-dimethoxyanilino)ethanol |
| SMILES | CC.CC.CC.CCN(CCO)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C12H19NO3.3C2H6/c1-4-13(7-8-14)10-5-6-11(15-2)12(9-10)16-3;3*1-2/h5-6,9,14H,4,7-8H2,1-3H3;3*1-2H3 |
| InChIKey | VAKUXCXGBOWFMW-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|