C17H21NO3 — CID 175433154
4-[(N-ethyl-3,4-dimethoxyanilino)methyl]phenol (PubChem CID 175433154) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 4-[(N-ethyl-3,4-dimethoxyanilino)methyl]phenol.
| Compound Name | 4-[(N-ethyl-3,4-dimethoxyanilino)methyl]phenol |
|---|---|
| PubChem CID | 175433154 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 4-[(N-ethyl-3,4-dimethoxyanilino)methyl]phenol |
| SMILES | CCN(Cc1ccc(O)cc1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C17H21NO3/c1-4-18(12-13-5-8-15(19)9-6-13)14-7-10-16(20-2)17(11-14)21-3/h5-11,19H,4,12H2,1-3H3 |
| InChIKey | FHOOUCAZRRKLDN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|