C12H19NO2 — CID 82538204
N,N-diethyl-3,4-dimethoxyaniline (PubChem CID 82538204) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is N,N-diethyl-3,4-dimethoxyaniline.
| Compound Name | N,N-diethyl-3,4-dimethoxyaniline |
|---|---|
| PubChem CID | 82538204 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | N,N-diethyl-3,4-dimethoxyaniline |
| SMILES | CCN(CC)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C12H19NO2/c1-5-13(6-2)10-7-8-11(14-3)12(9-10)15-4/h7-9H,5-6H2,1-4H3 |
| InChIKey | XUKREMQRQYAKLW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|