C10H14ClNO2 — CID 115262807
N-(chloromethyl)-3,4-dimethoxy-N-methylaniline (PubChem CID 115262807) has the molecular formula C10H14ClNO2 and a molecular weight of 215.68 g/mol. Its IUPAC name is N-(chloromethyl)-3,4-dimethoxy-N-methylaniline.
| Compound Name | N-(chloromethyl)-3,4-dimethoxy-N-methylaniline |
|---|---|
| PubChem CID | 115262807 |
| Molecular Formula | C10H14ClNO2 |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | N-(chloromethyl)-3,4-dimethoxy-N-methylaniline |
| SMILES | COc1ccc(N(C)CCl)cc1OC |
| InChI | InChI=1S/C10H14ClNO2/c1-12(7-11)8-4-5-9(13-2)10(6-8)14-3/h4-6H,7H2,1-3H3 |
| InChIKey | DIPYZGRWERCPGP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|