C9H13NO3 — CID 88903555
N-(3,4-dimethoxyphenyl)-N-methylhydroxylamine (PubChem CID 88903555) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-N-methylhydroxylamine.
| Compound Name | N-(3,4-dimethoxyphenyl)-N-methylhydroxylamine |
|---|---|
| PubChem CID | 88903555 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-N-methylhydroxylamine |
| SMILES | COc1ccc(N(C)O)cc1OC |
| InChI | InChI=1S/C9H13NO3/c1-10(11)7-4-5-8(12-2)9(6-7)13-3/h4-6,11H,1-3H3 |
| InChIKey | ICTSYOUQXQHOKT-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|