C16H27N3O4 — CID 91733734
3-[4-(diethylamino)-2-methoxyphenyl]-1,1-bis(2-hydroxyethyl)urea (PubChem CID 91733734) has the molecular formula C16H27N3O4 and a molecular weight of 325.41 g/mol. Its IUPAC name is 3-[4-(diethylamino)-2-methoxyphenyl]-1,1-bis(2-hydroxyethyl)urea.
| Compound Name | 3-[4-(diethylamino)-2-methoxyphenyl]-1,1-bis(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 91733734 |
| Molecular Formula | C16H27N3O4 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 3-[4-(diethylamino)-2-methoxyphenyl]-1,1-bis(2-hydroxyethyl)urea |
| SMILES | CCN(CC)c1ccc(NC(=O)N(CCO)CCO)c(OC)c1 |
| InChI | InChI=1S/C16H27N3O4/c1-4-18(5-2)13-6-7-14(15(12-13)23-3)17-16(22)19(8-10-20)9-11-21/h6-7,12,20-21H,4-5,8-11H2,1-3H3,(H,17,22) |
| InChIKey | LVLFVNXTULQCFI-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 85.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |