C24H35N3O6S — CID 83282578
[5-(diethylamino)-2-[[2-methoxyethyl-[(2-methoxyphenyl)carbamoyl]amino]methyl]phenyl] ethanesulfonate (PubChem CID 83282578) has the molecular formula C24H35N3O6S and a molecular weight of 493.63 g/mol. Its IUPAC name is [5-(diethylamino)-2-[[2-methoxyethyl-[(2-methoxyphenyl)carbamoyl]amino]methyl]phenyl] ethanesulfonate.
| Compound Name | [5-(diethylamino)-2-[[2-methoxyethyl-[(2-methoxyphenyl)carbamoyl]amino]methyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 83282578 |
| Molecular Formula | C24H35N3O6S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | [5-(diethylamino)-2-[[2-methoxyethyl-[(2-methoxyphenyl)carbamoyl]amino]methyl]phenyl] ethanesulfonate |
| SMILES | CCN(CC)c1ccc(CN(CCOC)C(=O)Nc2ccccc2OC)c(OS(=O)(=O)CC)c1 |
| InChI | InChI=1S/C24H35N3O6S/c1-6-26(7-2)20-14-13-19(23(17-20)33-34(29,30)8-3)18-27(15-16-31-4)24(28)25-21-11-9-10-12-22(21)32-5/h9-14,17H,6-8,15-16,18H2,1-5H3,(H,25,28) |
| InChIKey | XTULJJSMUJLGJM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|