C25H38N4O4S — CID 46111218
[5-(diethylamino)-2-[[2-(dimethylamino)ethyl-[(2-methylphenyl)carbamoyl]amino]methyl]phenyl] ethanesulfonate (PubChem CID 46111218) has the molecular formula C25H38N4O4S and a molecular weight of 490.67 g/mol. Its IUPAC name is [5-(diethylamino)-2-[[2-(dimethylamino)ethyl-[(2-methylphenyl)carbamoyl]amino]methyl]phenyl] ethanesulfonate.
| Compound Name | [5-(diethylamino)-2-[[2-(dimethylamino)ethyl-[(2-methylphenyl)carbamoyl]amino]methyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 46111218 |
| Molecular Formula | C25H38N4O4S |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | [5-(diethylamino)-2-[[2-(dimethylamino)ethyl-[(2-methylphenyl)carbamoyl]amino]methyl]phenyl] ethanesulfonate |
| SMILES | CCN(CC)c1ccc(CN(CCN(C)C)C(=O)Nc2ccccc2C)c(OS(=O)(=O)CC)c1 |
| InChI | InChI=1S/C25H38N4O4S/c1-7-28(8-2)22-15-14-21(24(18-22)33-34(31,32)9-3)19-29(17-16-27(5)6)25(30)26-23-13-11-10-12-20(23)4/h10-15,18H,7-9,16-17,19H2,1-6H3,(H,26,30) |
| InChIKey | UEKGNPGNKOKADG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|